Products 1017183-10-6
CAS 1017183-10-6 is the registry number for 3-[4-(Dimethylamino)phenyl]-2-methylpropanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-[4-(dimethylamino)phenyl]-2-methylpropanoic acid (CAS 1017183-10-6) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: 3-[4-(dimethylamino)phenyl]-2-methylpropanoic acid. InChIKey: HHNAQGXGRDEBJY-UHFFFAOYSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | 3-[4-(dimethylamino)phenyl]-2-methylpropanoic acid |
| InChIKey | HHNAQGXGRDEBJY-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC=C(C=C1)N(C)C)C(=O)O |
Computed by PubChem (NCBI)