Products 1017234-25-1
CAS 1017234-25-1 is the registry number for 3-((S)-1-(Methyl((S)-1-phenylethyl)amino)ethyl)phenyl ethyl(methyl)carbamate 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg.
[3-[(1S)-1-[methyl-[(1S)-1-phenylethyl]amino]ethyl]phenyl] N-ethyl-N-methylcarbamate (CAS 1017234-25-1) is a chemical compound with the molecular formula C21H28N2O2 and a molecular weight of 340.5 g/mol. IUPAC name: [3-[(1S)-1-[methyl-[(1S)-1-phenylethyl]amino]ethyl]phenyl] N-ethyl-N-methylcarbamate. InChIKey: OLRGQJSWDPAGIB-IRXDYDNUSA-N.
| Molecular formula | C21H28N2O2 |
|---|---|
| Molecular weight | 340.5 g/mol |
| IUPAC name | [3-[(1S)-1-[methyl-[(1S)-1-phenylethyl]amino]ethyl]phenyl] N-ethyl-N-methylcarbamate |
| InChIKey | OLRGQJSWDPAGIB-IRXDYDNUSA-N |
| SMILES | CCN(C)C(=O)OC1=CC=CC(=C1)[C@H](C)N(C)[C@@H](C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)