Products 870859-04-4
CAS 870859-04-4 is the registry number for Evocalcet Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-[[(1R)-1-naphthalen-1-ylethyl]amino]pyrrolidine-1-carboxylate (CAS 870859-04-4) is a chemical compound with the molecular formula C21H28N2O2 and a molecular weight of 340.5 g/mol. IUPAC name: tert-butyl 3-[[(1R)-1-naphthalen-1-ylethyl]amino]pyrrolidine-1-carboxylate. InChIKey: XGAGPDINHYNUKV-LDCVWXEPSA-N.
| Molecular formula | C21H28N2O2 |
|---|---|
| Molecular weight | 340.5 g/mol |
| IUPAC name | tert-butyl 3-[[(1R)-1-naphthalen-1-ylethyl]amino]pyrrolidine-1-carboxylate |
| InChIKey | XGAGPDINHYNUKV-LDCVWXEPSA-N |
| SMILES | C[C@H](C1=CC=CC2=CC=CC=C21)NC3CCN(C3)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)