Products 1329836-11-4
CAS 1329836-11-4 is the registry number for Decloxizine-d8 dihydrochloride. Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg.
2-[2-(4-benzhydryl-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)ethoxy]ethanol (CAS 1329836-11-4) is a chemical compound with the molecular formula C21H28N2O2 and a molecular weight of 348.5 g/mol. IUPAC name: 2-[2-(4-benzhydryl-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)ethoxy]ethanol. InChIKey: OXBBIHZWNDPBMQ-FUEQIQQISA-N.
| Molecular formula | C21H28N2O2 |
|---|---|
| Molecular weight | 348.5 g/mol |
| IUPAC name | 2-[2-(4-benzhydryl-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)ethoxy]ethanol |
| InChIKey | OXBBIHZWNDPBMQ-FUEQIQQISA-N |
| SMILES | [2H]C1(C(N(C(C(N1CCOCCO)([2H])[2H])([2H])[2H])C(C2=CC=CC=C2)C3=CC=CC=C3)([2H])[2H])[2H] |
Computed by PubChem (NCBI)