CAS 1017279-68-3 is the registry number for t-Butyl (2-iodo-4-methylphenyl)carbamate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g.
Tert-butyl N-(2-iodo-4-methylphenyl)carbamate (CAS 1017279-68-3) is a chemical compound with the molecular formula C12H16INO2 and a molecular weight of 333.16 g/mol. IUPAC name: tert-butyl N-(2-iodo-4-methylphenyl)carbamate. InChIKey: QPOLTYRLRAGNET-UHFFFAOYSA-N.
| Molecular formula | C12H16INO2 |
|---|---|
| Molecular weight | 333.16 g/mol |
| IUPAC name | tert-butyl N-(2-iodo-4-methylphenyl)carbamate |
| InChIKey | QPOLTYRLRAGNET-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC(=O)OC(C)(C)C)I |
Computed by PubChem (NCBI)