CAS 1221793-58-3 is the registry number for N-BOC 4-iodo-3-methylaniline, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Tert-butyl N-(4-iodo-3-methylphenyl)carbamate (CAS 1221793-58-3) is a chemical compound with the molecular formula C12H16INO2 and a molecular weight of 333.16 g/mol. IUPAC name: tert-butyl N-(4-iodo-3-methylphenyl)carbamate. InChIKey: ZIHVBSTUTDALJV-UHFFFAOYSA-N.
| Molecular formula | C12H16INO2 |
|---|---|
| Molecular weight | 333.16 g/mol |
| IUPAC name | tert-butyl N-(4-iodo-3-methylphenyl)carbamate |
| InChIKey | ZIHVBSTUTDALJV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)NC(=O)OC(C)(C)C)I |
Computed by PubChem (NCBI)