Products 101730-55-6

CAS 101730-55-6 is the registry number for 1-(Benzenesulfonyl)-4-phenylpiperidine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

1-(benzenesulfonyl)-4-phenylpiperidine-4-carboxylic acid (CAS 101730-55-6) is a chemical compound with the molecular formula C18H19NO4S and a molecular weight of 345.4 g/mol. IUPAC name: 1-(benzenesulfonyl)-4-phenylpiperidine-4-carboxylic acid. InChIKey: BPUOHSNLBQSJJC-UHFFFAOYSA-N.

Identity
Molecular formulaC18H19NO4S
Molecular weight345.4 g/mol
IUPAC name1-(benzenesulfonyl)-4-phenylpiperidine-4-carboxylic acid
InChIKeyBPUOHSNLBQSJJC-UHFFFAOYSA-N
SMILESC1CN(CCC1(C2=CC=CC=C2)C(=O)O)S(=O)(=O)C3=CC=CC=C3

Computed by PubChem (NCBI)