CAS 81593-57-9 is the registry number for 7-Methoxy-3-(4-methylbenzenesulfonyl)-2,3,4,5-tetrahydro-1H-3-benzazepin-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
8-methoxy-3-(4-methylphenyl)sulfonyl-2,4-dihydro-1H-3-benzazepin-5-one (CAS 81593-57-9) is a chemical compound with the molecular formula C18H19NO4S and a molecular weight of 345.4 g/mol. IUPAC name: 8-methoxy-3-(4-methylphenyl)sulfonyl-2,4-dihydro-1H-3-benzazepin-5-one. InChIKey: LVBJAHGGBLVTDF-UHFFFAOYSA-N.
| Molecular formula | C18H19NO4S |
|---|---|
| Molecular weight | 345.4 g/mol |
| IUPAC name | 8-methoxy-3-(4-methylphenyl)sulfonyl-2,4-dihydro-1H-3-benzazepin-5-one |
| InChIKey | LVBJAHGGBLVTDF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCC3=C(C=CC(=C3)OC)C(=O)C2 |
Computed by PubChem (NCBI)