Products 1017369-58-2

CAS 1017369-58-2 is the registry number for 2-(Thiophen-2-ylmethyl)butanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(thiophen-2-ylmethyl)butanoic acid (CAS 1017369-58-2) is a chemical compound with the molecular formula C9H12O2S and a molecular weight of 184.26 g/mol. IUPAC name: 2-(thiophen-2-ylmethyl)butanoic acid. InChIKey: KRFLKYJDVNURPF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12O2S
Molecular weight184.26 g/mol
IUPAC name2-(thiophen-2-ylmethyl)butanoic acid
InChIKeyKRFLKYJDVNURPF-UHFFFAOYSA-N
SMILESCCC(CC1=CC=CS1)C(=O)O

Computed by PubChem (NCBI)