CAS 1017386-68-3 appears in our catalog under these names: 7-Fluoro-3-(hydroxymethyl)-1,2-dihydroquinolin-2-one, 7-Fluoro-3-(Hydroxymethyl)-1,2-dihydroquinolin-2-one, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 5g.
7-fluoro-3-(hydroxymethyl)-1H-quinolin-2-one (CAS 1017386-68-3) is a chemical compound with the molecular formula C10H8FNO2 and a molecular weight of 193.17 g/mol. IUPAC name: 7-fluoro-3-(hydroxymethyl)-1H-quinolin-2-one. InChIKey: QPEUMKYVFQOKDD-UHFFFAOYSA-N.
| Molecular formula | C10H8FNO2 |
|---|---|
| Molecular weight | 193.17 g/mol |
| IUPAC name | 7-fluoro-3-(hydroxymethyl)-1H-quinolin-2-one |
| InChIKey | QPEUMKYVFQOKDD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)NC(=O)C(=C2)CO |
Computed by PubChem (NCBI)