CAS 1017417-05-8 appears in our catalog under these names: 1-(3,4-Dimethylphenyl)-2-oxopyrrolidine-3-carboxylic acid, 98%, 1-(3,4-Dimethylphenyl)-2-oxopyrrolidine-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
1-(3,4-dimethylphenyl)-2-oxopyrrolidine-3-carboxylic acid (CAS 1017417-05-8) is a chemical compound with the molecular formula C13H15NO3 and a molecular weight of 233.26 g/mol. IUPAC name: 1-(3,4-dimethylphenyl)-2-oxopyrrolidine-3-carboxylic acid. InChIKey: XDTJOZZZMUUAAV-UHFFFAOYSA-N.
| Molecular formula | C13H15NO3 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | 1-(3,4-dimethylphenyl)-2-oxopyrrolidine-3-carboxylic acid |
| InChIKey | XDTJOZZZMUUAAV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2CCC(C2=O)C(=O)O)C |
Computed by PubChem (NCBI)