CAS 1017586-97-8 is the registry number for N-(1,3-Dimethyl-1H-pyrazol-5-yl)-4-fluorobenzenesulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2,5-dimethylpyrazol-3-yl)-4-fluorobenzenesulfonamide (CAS 1017586-97-8) is a chemical compound with the molecular formula C11H12FN3O2S and a molecular weight of 269.30 g/mol. IUPAC name: N-(2,5-dimethylpyrazol-3-yl)-4-fluorobenzenesulfonamide. InChIKey: DMGMSQLVPPAYCY-UHFFFAOYSA-N.
| Molecular formula | C11H12FN3O2S |
|---|---|
| Molecular weight | 269.30 g/mol |
| IUPAC name | N-(2,5-dimethylpyrazol-3-yl)-4-fluorobenzenesulfonamide |
| InChIKey | DMGMSQLVPPAYCY-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)NS(=O)(=O)C2=CC=C(C=C2)F)C |
Computed by PubChem (NCBI)