CAS 1274553-11-5 is the registry number for 3-(2-Amino-6-fluoro-1H-benzo[d]imidazol-1-yl)tetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(1,1-dioxothiolan-3-yl)-6-fluorobenzimidazol-2-amine (CAS 1274553-11-5) is a chemical compound with the molecular formula C11H12FN3O2S and a molecular weight of 269.30 g/mol. IUPAC name: 1-(1,1-dioxothiolan-3-yl)-6-fluorobenzimidazol-2-amine. InChIKey: JEFNRJYFDCNFSL-UHFFFAOYSA-N.
| Molecular formula | C11H12FN3O2S |
|---|---|
| Molecular weight | 269.30 g/mol |
| IUPAC name | 1-(1,1-dioxothiolan-3-yl)-6-fluorobenzimidazol-2-amine |
| InChIKey | JEFNRJYFDCNFSL-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1N2C3=C(C=CC(=C3)F)N=C2N |
Computed by PubChem (NCBI)