Products 1017665-64-3
CAS 1017665-64-3 is the registry number for 3-Amino-5-(3,4-dimethoxyphenyl)-2-methylpyrazole, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
3-(3,4-dimethoxyphenyl)-1-methylpyrazol-5-amine (CAS 1017665-64-3) is a chemical compound with the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. IUPAC name: 3-(3,4-dimethoxyphenyl)-1-methylpyrazol-5-amine. InChIKey: VKVFNEGAFWMOFI-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O2 |
|---|---|
| Molecular weight | 233.27 g/mol |
| IUPAC name | 3-(3,4-dimethoxyphenyl)-1-methylpyrazol-5-amine |
| InChIKey | VKVFNEGAFWMOFI-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C2=CC(=C(C=C2)OC)OC)N |
Computed by PubChem (NCBI)