CAS 1017674-08-6 is the registry number for 3-(4-Bromobenzenesulfonyl)-2-methylpropanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(4-bromophenyl)sulfonyl-2-methylpropanoic acid (CAS 1017674-08-6) is a chemical compound with the molecular formula C10H11BrO4S and a molecular weight of 307.16 g/mol. IUPAC name: 3-(4-bromophenyl)sulfonyl-2-methylpropanoic acid. InChIKey: DGRVNRNXPFQHKO-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO4S |
|---|---|
| Molecular weight | 307.16 g/mol |
| IUPAC name | 3-(4-bromophenyl)sulfonyl-2-methylpropanoic acid |
| InChIKey | DGRVNRNXPFQHKO-UHFFFAOYSA-N |
| SMILES | CC(CS(=O)(=O)C1=CC=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)