Products 1338988-44-5

CAS 1338988-44-5 is the registry number for 4-(3-Bromobenzenesulfonyl)butanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-(3-bromophenyl)sulfonylbutanoic acid (CAS 1338988-44-5) is a chemical compound with the molecular formula C10H11BrO4S and a molecular weight of 307.16 g/mol. IUPAC name: 4-(3-bromophenyl)sulfonylbutanoic acid. InChIKey: XWUVYPJQUWYTJV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11BrO4S
Molecular weight307.16 g/mol
IUPAC name4-(3-bromophenyl)sulfonylbutanoic acid
InChIKeyXWUVYPJQUWYTJV-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)Br)S(=O)(=O)CCCC(=O)O

Computed by PubChem (NCBI)