CAS 1017778-05-0 is the registry number for 2-Methyl-5-(trifluoromethyl)phenol, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-methyl-5-(trifluoromethyl)phenol (CAS 1017778-05-0) is a chemical compound with the molecular formula C8H7F3O and a molecular weight of 176.14 g/mol. IUPAC name: 2-methyl-5-(trifluoromethyl)phenol. InChIKey: CBWYZBGMPOIRBC-UHFFFAOYSA-N.
| Molecular formula | C8H7F3O |
|---|---|
| Molecular weight | 176.14 g/mol |
| IUPAC name | 2-methyl-5-(trifluoromethyl)phenol |
| InChIKey | CBWYZBGMPOIRBC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(F)(F)F)O |
Computed by PubChem (NCBI)