CAS 10531-50-7 appears in our catalog under these names: (R)-(-)-Alpha-(trifluoromethyl)benzyl alcohol, 95%, (R)–2,2,2–Trifluoro–1–phenylethanol, (R)-(-)-alpha-(Trifluoromethyl)benzyl Alcohol, (R)-2,2,2-Trifluoro-1-phenylethanol 95+%, (-)-Phenyl(trifluoromethyl)carbinol, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
(1R)-2,2,2-trifluoro-1-phenylethanol (CAS 10531-50-7) is a chemical compound with the molecular formula C8H7F3O and a molecular weight of 176.14 g/mol. IUPAC name: (1R)-2,2,2-trifluoro-1-phenylethanol. InChIKey: VNOMEAQPOMDWSR-SSDOTTSWSA-N.
| Molecular formula | C8H7F3O |
|---|---|
| Molecular weight | 176.14 g/mol |
| IUPAC name | (1R)-2,2,2-trifluoro-1-phenylethanol |
| InChIKey | VNOMEAQPOMDWSR-SSDOTTSWSA-N |
| SMILES | C1=CC=C(C=C1)[C@H](C(F)(F)F)O |
Computed by PubChem (NCBI)