CAS 1017802-89-9 is the registry number for ethyl 3–acetamido–5–bromo–1–methyl–1H–pyrazole–4–carboxylate. Offered by: GLPBio. Available pack sizes: 250mg.
Ethyl 3-acetamido-5-bromo-1-methylpyrazole-4-carboxylate (CAS 1017802-89-9) is a chemical compound with the molecular formula C9H12BrN3O3 and a molecular weight of 290.11 g/mol. IUPAC name: ethyl 3-acetamido-5-bromo-1-methylpyrazole-4-carboxylate. InChIKey: QCLBMJPSVPRPLE-UHFFFAOYSA-N.
| Molecular formula | C9H12BrN3O3 |
|---|---|
| Molecular weight | 290.11 g/mol |
| IUPAC name | ethyl 3-acetamido-5-bromo-1-methylpyrazole-4-carboxylate |
| InChIKey | QCLBMJPSVPRPLE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1NC(=O)C)C)Br |
Computed by PubChem (NCBI)