Products 2383555-19-7

CAS 2383555-19-7 is the registry number for Methyl 3-bromo-1-(tetrahydro-2H-pyran-2-yl)-1H-1,2,4-triazole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 5-bromo-2-(oxan-2-yl)-1,2,4-triazole-3-carboxylate (CAS 2383555-19-7) is a chemical compound with the molecular formula C9H12BrN3O3 and a molecular weight of 290.11 g/mol. IUPAC name: methyl 5-bromo-2-(oxan-2-yl)-1,2,4-triazole-3-carboxylate. InChIKey: NHZVWCGYCTVPBH-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12BrN3O3
Molecular weight290.11 g/mol
IUPAC namemethyl 5-bromo-2-(oxan-2-yl)-1,2,4-triazole-3-carboxylate
InChIKeyNHZVWCGYCTVPBH-UHFFFAOYSA-N
SMILESCOC(=O)C1=NC(=NN1C2CCCCO2)Br

Computed by PubChem (NCBI)