CAS 1018047-97-6 is the registry number for 4-(Difluoromethyl)-3-methylisoxazolo(5,4-b)pyridin-6(7H)-one. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
4-(difluoromethyl)-3-methyl-7H-[1,2]oxazolo[5,4-b]pyridin-6-one (CAS 1018047-97-6) is a chemical compound with the molecular formula C8H6F2N2O2 and a molecular weight of 200.14 g/mol. IUPAC name: 4-(difluoromethyl)-3-methyl-7H-[1,2]oxazolo[5,4-b]pyridin-6-one. InChIKey: HCVJWCBYROOTCW-UHFFFAOYSA-N.
| Molecular formula | C8H6F2N2O2 |
|---|---|
| Molecular weight | 200.14 g/mol |
| IUPAC name | 4-(difluoromethyl)-3-methyl-7H-[1,2]oxazolo[5,4-b]pyridin-6-one |
| InChIKey | HCVJWCBYROOTCW-UHFFFAOYSA-N |
| SMILES | CC1=NOC2=C1C(=CC(=O)N2)C(F)F |
Computed by PubChem (NCBI)