CAS 170108-12-0 appears in our catalog under these names: (E)-N-(2,3-Difluorophenyl)-2-(hydroxyimino)acetamide, 95%, N–(2,3–difluorophenyl)–2–(N–hydroxyimino)acetamide. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
(2E)-N-(2,3-difluorophenyl)-2-hydroxyiminoacetamide (CAS 170108-12-0) is a chemical compound with the molecular formula C8H6F2N2O2 and a molecular weight of 200.14 g/mol. IUPAC name: (2E)-N-(2,3-difluorophenyl)-2-hydroxyiminoacetamide. InChIKey: YMBBUGISGQLGIK-NYYWCZLTSA-N.
| Molecular formula | C8H6F2N2O2 |
|---|---|
| Molecular weight | 200.14 g/mol |
| IUPAC name | (2E)-N-(2,3-difluorophenyl)-2-hydroxyiminoacetamide |
| InChIKey | YMBBUGISGQLGIK-NYYWCZLTSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)NC(=O)/C=N/O |
Computed by PubChem (NCBI)