CAS 1018125-33-1 is the registry number for 3-(2-Chloro-3,4,5-trimethoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
3-(2-chloro-3,4,5-trimethoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid (CAS 1018125-33-1) is a chemical compound with the molecular formula C13H14ClNO6 and a molecular weight of 315.70 g/mol. IUPAC name: 3-(2-chloro-3,4,5-trimethoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid. InChIKey: WXNLLUXMWJBDLU-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO6 |
|---|---|
| Molecular weight | 315.70 g/mol |
| IUPAC name | 3-(2-chloro-3,4,5-trimethoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid |
| InChIKey | WXNLLUXMWJBDLU-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C(=C1)C2=NOC(C2)C(=O)O)Cl)OC)OC |
Computed by PubChem (NCBI)