CAS 2677030-78-1 is the registry number for Methyl 2-(2-(3-chloro-2-nitrobenzyl)-1,3-dioxolan-2-yl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-[2-[(3-chloro-2-nitrophenyl)methyl]-1,3-dioxolan-2-yl]acetate (CAS 2677030-78-1) is a chemical compound with the molecular formula C13H14ClNO6 and a molecular weight of 315.70 g/mol. IUPAC name: methyl 2-[2-[(3-chloro-2-nitrophenyl)methyl]-1,3-dioxolan-2-yl]acetate. InChIKey: CLMXILYGJODMJB-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO6 |
|---|---|
| Molecular weight | 315.70 g/mol |
| IUPAC name | methyl 2-[2-[(3-chloro-2-nitrophenyl)methyl]-1,3-dioxolan-2-yl]acetate |
| InChIKey | CLMXILYGJODMJB-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1(OCCO1)CC2=C(C(=CC=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)