Products 1018126-93-6
CAS 1018126-93-6 is the registry number for 3-(2-Ethyl-6-oxo-4-(trifluoromethyl)-2H,6H,7H-pyrazolo(3,4-b)pyridin-7-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-[2-ethyl-6-oxo-4-(trifluoromethyl)pyrazolo[3,4-b]pyridin-7-yl]propanoic acid (CAS 1018126-93-6) is a chemical compound with the molecular formula C12H12F3N3O3 and a molecular weight of 303.24 g/mol. IUPAC name: 3-[2-ethyl-6-oxo-4-(trifluoromethyl)pyrazolo[3,4-b]pyridin-7-yl]propanoic acid. InChIKey: BQOLABBIXZTGAH-UHFFFAOYSA-N.
| Molecular formula | C12H12F3N3O3 |
|---|---|
| Molecular weight | 303.24 g/mol |
| IUPAC name | 3-[2-ethyl-6-oxo-4-(trifluoromethyl)pyrazolo[3,4-b]pyridin-7-yl]propanoic acid |
| InChIKey | BQOLABBIXZTGAH-UHFFFAOYSA-N |
| SMILES | CCN1C=C2C(=CC(=O)N(C2=N1)CCC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)