CAS 1255717-05-5 is the registry number for [1-(3-Phenyl-1,2,4-oxadiazol-5-yl)ethyl]amine trifluoroacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.
1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine;2,2,2-trifluoroacetic acid (CAS 1255717-05-5) is a chemical compound with the molecular formula C12H12F3N3O3 and a molecular weight of 303.24 g/mol. IUPAC name: 1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine;2,2,2-trifluoroacetic acid. InChIKey: OJOXGLYUJDLYHE-UHFFFAOYSA-N.
| Molecular formula | C12H12F3N3O3 |
|---|---|
| Molecular weight | 303.24 g/mol |
| IUPAC name | 1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine;2,2,2-trifluoroacetic acid |
| InChIKey | OJOXGLYUJDLYHE-UHFFFAOYSA-N |
| SMILES | CC(C1=NC(=NO1)C2=CC=CC=C2)N.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)