Products 1255717-05-5

CAS 1255717-05-5 is the registry number for [1-(3-Phenyl-1,2,4-oxadiazol-5-yl)ethyl]amine trifluoroacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine;2,2,2-trifluoroacetic acid (CAS 1255717-05-5) is a chemical compound with the molecular formula C12H12F3N3O3 and a molecular weight of 303.24 g/mol. IUPAC name: 1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine;2,2,2-trifluoroacetic acid. InChIKey: OJOXGLYUJDLYHE-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12F3N3O3
Molecular weight303.24 g/mol
IUPAC name1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine;2,2,2-trifluoroacetic acid
InChIKeyOJOXGLYUJDLYHE-UHFFFAOYSA-N
SMILESCC(C1=NC(=NO1)C2=CC=CC=C2)N.C(=O)(C(F)(F)F)O

Computed by PubChem (NCBI)