CAS 1018128-29-4 is the registry number for 6-Chloro-4-(difluoromethyl)-2-propyl-2H-pyrazolo(3,4-b)pyridine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-chloro-4-(difluoromethyl)-2-propylpyrazolo[3,4-b]pyridine (CAS 1018128-29-4) is a chemical compound with the molecular formula C10H10ClF2N3 and a molecular weight of 245.65 g/mol. IUPAC name: 6-chloro-4-(difluoromethyl)-2-propylpyrazolo[3,4-b]pyridine. InChIKey: RZRNIWQRVOAGOG-UHFFFAOYSA-N.
| Molecular formula | C10H10ClF2N3 |
|---|---|
| Molecular weight | 245.65 g/mol |
| IUPAC name | 6-chloro-4-(difluoromethyl)-2-propylpyrazolo[3,4-b]pyridine |
| InChIKey | RZRNIWQRVOAGOG-UHFFFAOYSA-N |
| SMILES | CCCN1C=C2C(=CC(=NC2=N1)Cl)C(F)F |
Computed by PubChem (NCBI)