CAS 2097891-03-5 is the registry number for (1-(2,6-Difluorophenyl)-1H-pyrazol-3-yl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
[1-(2,6-difluorophenyl)pyrazol-3-yl]methanamine;hydrochloride (CAS 2097891-03-5) is a chemical compound with the molecular formula C10H10ClF2N3 and a molecular weight of 245.65 g/mol. IUPAC name: [1-(2,6-difluorophenyl)pyrazol-3-yl]methanamine;hydrochloride. InChIKey: LENPPJBYFDAMRK-UHFFFAOYSA-N.
| Molecular formula | C10H10ClF2N3 |
|---|---|
| Molecular weight | 245.65 g/mol |
| IUPAC name | [1-(2,6-difluorophenyl)pyrazol-3-yl]methanamine;hydrochloride |
| InChIKey | LENPPJBYFDAMRK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)N2C=CC(=N2)CN)F.Cl |
Computed by PubChem (NCBI)