Products 1018165-10-0
CAS 1018165-10-0 is the registry number for 6-Chloro-2-methyl-4-(trifluoromethyl)-2H-pyrazolo(3,4-b)pyridine. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
6-chloro-2-methyl-4-(trifluoromethyl)pyrazolo[3,4-b]pyridine (CAS 1018165-10-0) is a chemical compound with the molecular formula C8H5ClF3N3 and a molecular weight of 235.59 g/mol. IUPAC name: 6-chloro-2-methyl-4-(trifluoromethyl)pyrazolo[3,4-b]pyridine. InChIKey: XQLQKEWMWAZHFO-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF3N3 |
|---|---|
| Molecular weight | 235.59 g/mol |
| IUPAC name | 6-chloro-2-methyl-4-(trifluoromethyl)pyrazolo[3,4-b]pyridine |
| InChIKey | XQLQKEWMWAZHFO-UHFFFAOYSA-N |
| SMILES | CN1C=C2C(=CC(=NC2=N1)Cl)C(F)(F)F |
Computed by PubChem (NCBI)