CAS 1467492-14-3 is the registry number for 7-CHLORO-5-METHYL-2-(TRIFLUOROMETHYL)PYRAZOLO[1,5-A]PYRIMIDINE, 95%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
7-chloro-5-methyl-2-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine (CAS 1467492-14-3) is a chemical compound with the molecular formula C8H5ClF3N3 and a molecular weight of 235.59 g/mol. IUPAC name: 7-chloro-5-methyl-2-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine. InChIKey: JZHVTGYREDVBGU-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF3N3 |
|---|---|
| Molecular weight | 235.59 g/mol |
| IUPAC name | 7-chloro-5-methyl-2-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine |
| InChIKey | JZHVTGYREDVBGU-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC(=NN2C(=C1)Cl)C(F)(F)F |
Computed by PubChem (NCBI)