CAS 10182-68-0 is the registry number for 5-Allyl-2,4,6-trichloropyrimidine, 95% +(stabilized with TBC). Offered by: Chemat Brand. Available pack sizes: on request.
2,4,6-trichloro-5-prop-2-enylpyrimidine (CAS 10182-68-0) is a chemical compound with the molecular formula C7H5Cl3N2 and a molecular weight of 223.5 g/mol. IUPAC name: 2,4,6-trichloro-5-prop-2-enylpyrimidine. InChIKey: RXPZJYKGHXZIEJ-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl3N2 |
|---|---|
| Molecular weight | 223.5 g/mol |
| IUPAC name | 2,4,6-trichloro-5-prop-2-enylpyrimidine |
| InChIKey | RXPZJYKGHXZIEJ-UHFFFAOYSA-N |
| SMILES | C=CCC1=C(N=C(N=C1Cl)Cl)Cl |
Computed by PubChem (NCBI)