Products 2378501-67-6

CAS 2378501-67-6 is the registry number for 2,6-Dichloro-1h-1,3-benzodiazole hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2,6-dichloro-1H-benzimidazole;hydrochloride (CAS 2378501-67-6) is a chemical compound with the molecular formula C7H5Cl3N2 and a molecular weight of 223.5 g/mol. IUPAC name: 2,6-dichloro-1H-benzimidazole;hydrochloride. InChIKey: LDHJEZVGCVKJJQ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5Cl3N2
Molecular weight223.5 g/mol
IUPAC name2,6-dichloro-1H-benzimidazole;hydrochloride
InChIKeyLDHJEZVGCVKJJQ-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1Cl)NC(=N2)Cl.Cl

Computed by PubChem (NCBI)