CAS 2378501-67-6 is the registry number for 2,6-Dichloro-1h-1,3-benzodiazole hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2,6-dichloro-1H-benzimidazole;hydrochloride (CAS 2378501-67-6) is a chemical compound with the molecular formula C7H5Cl3N2 and a molecular weight of 223.5 g/mol. IUPAC name: 2,6-dichloro-1H-benzimidazole;hydrochloride. InChIKey: LDHJEZVGCVKJJQ-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl3N2 |
|---|---|
| Molecular weight | 223.5 g/mol |
| IUPAC name | 2,6-dichloro-1H-benzimidazole;hydrochloride |
| InChIKey | LDHJEZVGCVKJJQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)NC(=N2)Cl.Cl |
Computed by PubChem (NCBI)