Products 1018503-75-7

CAS 1018503-75-7 appears in our catalog under these names: 1-(Cyclopentylcarbamoyl)piperidine-3-carboxylic acid, 95%, 1-(Cyclopentylcarbamoyl)piperidine-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

1-(cyclopentylcarbamoyl)piperidine-3-carboxylic acid (CAS 1018503-75-7) is a chemical compound with the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. IUPAC name: 1-(cyclopentylcarbamoyl)piperidine-3-carboxylic acid. InChIKey: GUJQGXPEJFDCGP-UHFFFAOYSA-N.

Identity
Molecular formulaC12H20N2O3
Molecular weight240.30 g/mol
IUPAC name1-(cyclopentylcarbamoyl)piperidine-3-carboxylic acid
InChIKeyGUJQGXPEJFDCGP-UHFFFAOYSA-N
SMILESC1CCC(C1)NC(=O)N2CCCC(C2)C(=O)O

Computed by PubChem (NCBI)