Products 1018504-63-6

CAS 1018504-63-6 is the registry number for 1-((Propan-2-yl)carbamoyl)piperidine-4-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

1-(propan-2-ylcarbamoyl)piperidine-4-carboxylic acid (CAS 1018504-63-6) is a chemical compound with the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. IUPAC name: 1-(propan-2-ylcarbamoyl)piperidine-4-carboxylic acid. InChIKey: NNVNEGUYUNQMTQ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H18N2O3
Molecular weight214.26 g/mol
IUPAC name1-(propan-2-ylcarbamoyl)piperidine-4-carboxylic acid
InChIKeyNNVNEGUYUNQMTQ-UHFFFAOYSA-N
SMILESCC(C)NC(=O)N1CCC(CC1)C(=O)O

Computed by PubChem (NCBI)