Products 1018563-25-1
CAS 1018563-25-1 is the registry number for 5-(4-Aminophenyl)-N,N-dimethyl-1,3,4-oxadiazol-2-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-(4-aminophenyl)-N,N-dimethyl-1,3,4-oxadiazol-2-amine (CAS 1018563-25-1) is a chemical compound with the molecular formula C10H12N4O and a molecular weight of 204.23 g/mol. IUPAC name: 5-(4-aminophenyl)-N,N-dimethyl-1,3,4-oxadiazol-2-amine. InChIKey: LSWJPMBYQNNEKR-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O |
|---|---|
| Molecular weight | 204.23 g/mol |
| IUPAC name | 5-(4-aminophenyl)-N,N-dimethyl-1,3,4-oxadiazol-2-amine |
| InChIKey | LSWJPMBYQNNEKR-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NN=C(O1)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)