CAS 1018673-42-1 appears in our catalog under these names: HDAC-IN-3/ 99.62% (existing batch purity), GSK3117391, HDAC-IN-3, GSK3117391, 99%, 99%, GSK3117391, 99.40%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 25 mg, 10 mg.
Cyclopentyl (2S)-2-cyclohexyl-2-[[6-[3-(hydroxyamino)-3-oxopropyl]-3-pyridinyl]methylamino]acetate (CAS 1018673-42-1) is a chemical compound with the molecular formula C22H33N3O4 and a molecular weight of 403.5 g/mol. IUPAC name: cyclopentyl (2S)-2-cyclohexyl-2-[[6-[3-(hydroxyamino)-3-oxopropyl]-3-pyridinyl]methylamino]acetate. InChIKey: AFDPFLDWOXXHQM-NRFANRHFSA-N.
| Molecular formula | C22H33N3O4 |
|---|---|
| Molecular weight | 403.5 g/mol |
| IUPAC name | cyclopentyl (2S)-2-cyclohexyl-2-[[6-[3-(hydroxyamino)-3-oxopropyl]-3-pyridinyl]methylamino]acetate |
| InChIKey | AFDPFLDWOXXHQM-NRFANRHFSA-N |
| SMILES | C1CCC(CC1)[C@@H](C(=O)OC2CCCC2)NCC3=CN=C(C=C3)CCC(=O)NO |
Computed by PubChem (NCBI)