Products 1639963-94-2

CAS 1639963-94-2 is the registry number for 9-Benzyl 4-(tert-butyl) 1,4,9-triazaspiro[5.6]dodecane-4,9-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

10-O-benzyl 4-O-tert-butyl 1,4,10-triazaspiro[5.6]dodecane-4,10-dicarboxylate (CAS 1639963-94-2) is a chemical compound with the molecular formula C22H33N3O4 and a molecular weight of 403.5 g/mol. IUPAC name: 10-O-benzyl 4-O-tert-butyl 1,4,10-triazaspiro[5.6]dodecane-4,10-dicarboxylate. InChIKey: KMSUUURLBMUGNO-UHFFFAOYSA-N.

Identity
Molecular formulaC22H33N3O4
Molecular weight403.5 g/mol
IUPAC name10-O-benzyl 4-O-tert-butyl 1,4,10-triazaspiro[5.6]dodecane-4,10-dicarboxylate
InChIKeyKMSUUURLBMUGNO-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCNC2(C1)CCCN(CC2)C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)