CAS 1018676-03-3 is the registry number for 5-((1-Pyrrolidinylsulfonyl)methyl)-1H-indole-3-ethanamine Ethanedioate (1:1). Offered by: TRC. Available pack sizes: 100mg.
Oxalic acid;2-[5-(pyrrolidin-1-ylsulfonylmethyl)-1H-indol-3-yl]ethanamine (CAS 1018676-03-3) is a chemical compound with the molecular formula C17H23N3O6S and a molecular weight of 397.4 g/mol. IUPAC name: oxalic acid;2-[5-(pyrrolidin-1-ylsulfonylmethyl)-1H-indol-3-yl]ethanamine. InChIKey: IUJGCTDCBPYLAM-UHFFFAOYSA-N.
| Molecular formula | C17H23N3O6S |
|---|---|
| Molecular weight | 397.4 g/mol |
| IUPAC name | oxalic acid;2-[5-(pyrrolidin-1-ylsulfonylmethyl)-1H-indol-3-yl]ethanamine |
| InChIKey | IUJGCTDCBPYLAM-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)S(=O)(=O)CC2=CC3=C(C=C2)NC=C3CCN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)