Products 6803-17-4
CAS 6803-17-4 appears in our catalog under these names: S–Benzylglutathione, S-Benzylglutathione, 98.86%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 5mg, 10 mg, 5 mg.
(2S)-2-amino-5-[[(2R)-3-benzylsulfanyl-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid (CAS 6803-17-4) is a chemical compound with the molecular formula C17H23N3O6S and a molecular weight of 397.4 g/mol. IUPAC name: (2S)-2-amino-5-[[(2R)-3-benzylsulfanyl-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid. InChIKey: XYJWEQWNNKNSFU-STQMWFEESA-N.
| Molecular formula | C17H23N3O6S |
|---|---|
| Molecular weight | 397.4 g/mol |
| IUPAC name | (2S)-2-amino-5-[[(2R)-3-benzylsulfanyl-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| InChIKey | XYJWEQWNNKNSFU-STQMWFEESA-N |
| SMILES | C1=CC=C(C=C1)CSC[C@@H](C(=O)NCC(=O)O)NC(=O)CC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)