CAS 1019-60-9 appears in our catalog under these names: 5-Hydroxy-7-methoxy-2,2-dimethyl-2,3-dihydro-4h-chromen-4-one, 95%, 5-HYDROXY-7-METHOXY-2,2-DIMETHYLCHROMAN-4-ONE, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
5-hydroxy-7-methoxy-2,2-dimethyl-3H-chromen-4-one (CAS 1019-60-9) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: 5-hydroxy-7-methoxy-2,2-dimethyl-3H-chromen-4-one. InChIKey: SBXQRIDZIXLNSM-UHFFFAOYSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 5-hydroxy-7-methoxy-2,2-dimethyl-3H-chromen-4-one |
| InChIKey | SBXQRIDZIXLNSM-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C2=C(C=C(C=C2O1)OC)O)C |
Computed by PubChem (NCBI)