CAS 1019008-75-3 is the registry number for 5,6-Dimethyl-3-(3-methylphenyl)thieno[2,3-d]pyrimidine-2,4(1h,3h)-dione, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5,6-dimethyl-3-(3-methylphenyl)-1H-thieno[2,3-d]pyrimidine-2,4-dione (CAS 1019008-75-3) is a chemical compound with the molecular formula C15H14N2O2S and a molecular weight of 286.4 g/mol. IUPAC name: 5,6-dimethyl-3-(3-methylphenyl)-1H-thieno[2,3-d]pyrimidine-2,4-dione. InChIKey: CAYORWOQEXJAAN-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O2S |
|---|---|
| Molecular weight | 286.4 g/mol |
| IUPAC name | 5,6-dimethyl-3-(3-methylphenyl)-1H-thieno[2,3-d]pyrimidine-2,4-dione |
| InChIKey | CAYORWOQEXJAAN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N2C(=O)C3=C(NC2=O)SC(=C3C)C |
Computed by PubChem (NCBI)