CAS 1455245-47-2 is the registry number for 2-(2,4-Dimethylphenoxymethyl)-3H,4H-thieno(3,2-d)pyrimidin-4-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-[(2,4-dimethylphenoxy)methyl]-3H-thieno[3,2-d]pyrimidin-4-one (CAS 1455245-47-2) is a chemical compound with the molecular formula C15H14N2O2S and a molecular weight of 286.4 g/mol. IUPAC name: 2-[(2,4-dimethylphenoxy)methyl]-3H-thieno[3,2-d]pyrimidin-4-one. InChIKey: VEWUDLNPBCBRKH-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O2S |
|---|---|
| Molecular weight | 286.4 g/mol |
| IUPAC name | 2-[(2,4-dimethylphenoxy)methyl]-3H-thieno[3,2-d]pyrimidin-4-one |
| InChIKey | VEWUDLNPBCBRKH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OCC2=NC3=C(C(=O)N2)SC=C3)C |
Computed by PubChem (NCBI)