CAS 1019075-43-4 is the registry number for 1-(5-Methyl-1-phenyl-1h-pyrazol-4-yl)ethanone oxime, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(NE)-N-[1-(5-methyl-1-phenylpyrazol-4-yl)ethylidene]hydroxylamine (CAS 1019075-43-4) is a chemical compound with the molecular formula C12H13N3O and a molecular weight of 215.25 g/mol. IUPAC name: (NE)-N-[1-(5-methyl-1-phenylpyrazol-4-yl)ethylidene]hydroxylamine. InChIKey: IWAIVJFFDTYYFK-NTEUORMPSA-N.
| Molecular formula | C12H13N3O |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | (NE)-N-[1-(5-methyl-1-phenylpyrazol-4-yl)ethylidene]hydroxylamine |
| InChIKey | IWAIVJFFDTYYFK-NTEUORMPSA-N |
| SMILES | CC1=C(C=NN1C2=CC=CC=C2)/C(=N/O)/C |
Computed by PubChem (NCBI)