CAS 1105194-40-8 appears in our catalog under these names: 5-(5,6,7,8-Tetrahydronaphthalen-2-yl)-1,3,4-oxadiazol-2-amine, 95%, 5-(5,6,7,8-Tetrahydronaphthalen-2-yl)-1,3,4-oxadiazol-2-amine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3,4-oxadiazol-2-amine (CAS 1105194-40-8) is a chemical compound with the molecular formula C12H13N3O and a molecular weight of 215.25 g/mol. IUPAC name: 5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3,4-oxadiazol-2-amine. InChIKey: UBAJJOROZBBPEO-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3,4-oxadiazol-2-amine |
| InChIKey | UBAJJOROZBBPEO-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C=CC(=C2)C3=NN=C(O3)N |
Computed by PubChem (NCBI)