CAS 1019115-53-7 is the registry number for 7-fluoro-4-methyl-1,3-benzothiazol-2-amine, 95%+, 95%+. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
7-fluoro-4-methyl-1,3-benzothiazol-2-amine (CAS 1019115-53-7) is a chemical compound with the molecular formula C8H7FN2S and a molecular weight of 182.22 g/mol. IUPAC name: 7-fluoro-4-methyl-1,3-benzothiazol-2-amine. InChIKey: ZFFMZYZWYXJQER-UHFFFAOYSA-N.
| Molecular formula | C8H7FN2S |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 7-fluoro-4-methyl-1,3-benzothiazol-2-amine |
| InChIKey | ZFFMZYZWYXJQER-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)F)SC(=N2)N |
Computed by PubChem (NCBI)