CAS 1610021-29-8 appears in our catalog under these names: 5-Fluoro-2-methylbenzo[d]thiazol-6-amine, 95%, 5-Fluoro-2-methylbenzo[d]thiazol-6-amine 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 5g, 100mg, 1g, 50mg.
5-fluoro-2-methyl-1,3-benzothiazol-6-amine (CAS 1610021-29-8) is a chemical compound with the molecular formula C8H7FN2S and a molecular weight of 182.22 g/mol. IUPAC name: 5-fluoro-2-methyl-1,3-benzothiazol-6-amine. InChIKey: RZXGPTUMFPEXGU-UHFFFAOYSA-N.
| Molecular formula | C8H7FN2S |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 5-fluoro-2-methyl-1,3-benzothiazol-6-amine |
| InChIKey | RZXGPTUMFPEXGU-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C=C(C(=C2)F)N |
Computed by PubChem (NCBI)