Products 1019132-74-1
CAS 1019132-74-1 is the registry number for N-(2-Methoxy-5-methylphenyl)-2-methyl-6-(3-methylphenyl)pyrimidin-4-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
N-(2-methoxy-5-methylphenyl)-2-methyl-6-(3-methylphenyl)pyrimidin-4-amine (CAS 1019132-74-1) is a chemical compound with the molecular formula C20H21N3O and a molecular weight of 319.4 g/mol. IUPAC name: N-(2-methoxy-5-methylphenyl)-2-methyl-6-(3-methylphenyl)pyrimidin-4-amine. InChIKey: IRMCDDKNQRGCTD-UHFFFAOYSA-N.
| Molecular formula | C20H21N3O |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | N-(2-methoxy-5-methylphenyl)-2-methyl-6-(3-methylphenyl)pyrimidin-4-amine |
| InChIKey | IRMCDDKNQRGCTD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=CC(=NC(=N2)C)NC3=C(C=CC(=C3)C)OC |
Computed by PubChem (NCBI)