CAS 1019150-05-0 appears in our catalog under these names: 1-[(4-Bromophenyl)methyl]-1h-1,2,4-triazol-3-amine, 95%, 1-((4-Bromophenyl)methyl)-1H-1,2,4-triazol-3-amine, 95%, 1-((4-Bromophenyl)methyl)-1H-1,2,4-triazol-3-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
1-[(4-bromophenyl)methyl]-1,2,4-triazol-3-amine (CAS 1019150-05-0) is a chemical compound with the molecular formula C9H9BrN4 and a molecular weight of 253.10 g/mol. IUPAC name: 1-[(4-bromophenyl)methyl]-1,2,4-triazol-3-amine. InChIKey: JXKBLVJNRQHKQT-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN4 |
|---|---|
| Molecular weight | 253.10 g/mol |
| IUPAC name | 1-[(4-bromophenyl)methyl]-1,2,4-triazol-3-amine |
| InChIKey | JXKBLVJNRQHKQT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=NC(=N2)N)Br |
Computed by PubChem (NCBI)