CAS 1454682-79-1 is the registry number for 6-bromo-N,7-dimethylpyrido[2,3-d]pyrimidin-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-N,7-dimethylpyrido[2,3-d]pyrimidin-2-amine (CAS 1454682-79-1) is a chemical compound with the molecular formula C9H9BrN4 and a molecular weight of 253.10 g/mol. IUPAC name: 6-bromo-N,7-dimethylpyrido[2,3-d]pyrimidin-2-amine. InChIKey: VXIPPNFZDKMJAD-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN4 |
|---|---|
| Molecular weight | 253.10 g/mol |
| IUPAC name | 6-bromo-N,7-dimethylpyrido[2,3-d]pyrimidin-2-amine |
| InChIKey | VXIPPNFZDKMJAD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C2C=NC(=NC2=N1)NC)Br |
Computed by PubChem (NCBI)