CAS 1019363-01-9 is the registry number for N-(Furan-2-ylmethyl)-4-hydroxybenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-(furan-2-ylmethyl)-4-hydroxybenzamide (CAS 1019363-01-9) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: N-(furan-2-ylmethyl)-4-hydroxybenzamide. InChIKey: JQRWLVSQDVROMZ-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | N-(furan-2-ylmethyl)-4-hydroxybenzamide |
| InChIKey | JQRWLVSQDVROMZ-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)CNC(=O)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)